About CID 135034209
CID 135034209 (PubChem CID 135034209) has the molecular formula C29H24F3N3O4
and a molecular weight of 535.52 g/mol.
Molecular Properties
| Compound Name | CID 135034209 |
| PubChem CID | 135034209 |
| Molecular Formula | C29H24F3N3O4 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@H]1[C@H](C(F)(F)F)N[C@]2(C(=O)N(Cc3ccccc3)c3ccccc32)[C@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C29H24F3N3O4/c1-34-20-14-8-6-12-18(20)27(25(34)37)22(24(36)39-2)23(29(30,31)32)33-28(27)19-13-7-9-15-21(19)35(26(28)38)16-17-10-4-3-5-11-17/h3-15,22-23,33H,16H2,1-2H3/t22-,23-,27+,28-/m1/s1 |
| InChIKey | MXUXMUPJBWBJCZ-SFUJYVBYSA-N |
| XLogP | 3.67 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 135034209 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135034209?
The IUPAC name of CID 135034209 (CID 135034209) is not available.
What is the SMILES notation for CID 135034209?
The canonical SMILES for CID 135034209 is COC(=O)[C@H]1[C@H](C(F)(F)F)N[C@]2(C(=O)N(Cc3ccccc3)c3ccccc32)[C@]12C(=O)N(C)c1ccccc12.
What is the InChIKey of CID 135034209?
The InChIKey is MXUXMUPJBWBJCZ-SFUJYVBYSA-N. The full InChI is InChI=1S/C29H24F3N3O4/c1-34-20-14-8-6-12-18(20)27(25(34)37)22(24(36)39-2)23(29(30,31)32)33-28(27)19-13-7-9-15-21(19)35(26(28)38)16-17-10-4-3-5-11-17/h3-15,22-23,33H,16H2,1-2H3/t22-,23-,27+,28-/m1/s1.
What are the key properties of CID 135034209?
CID 135034209 has a molecular weight of 535.52 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135034209 is sourced from PubChem (CID 135034209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).