C17H14BrNO4 — CID 135034374
2-(7-bromo-1-methyl-2-oxoquinoline-3-carbonyl)cyclohexane-1,3-dione (PubChem CID 135034374) has the molecular formula C17H14BrNO4 and a molecular weight of 376.21 g/mol. Its IUPAC name is 2-(7-bromo-1-methyl-2-oxoquinoline-3-carbonyl)cyclohexane-1,3-dione.
| Compound Name | 2-(7-bromo-1-methyl-2-oxoquinoline-3-carbonyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 135034374 |
| Molecular Formula | C17H14BrNO4 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 2-(7-bromo-1-methyl-2-oxoquinoline-3-carbonyl)cyclohexane-1,3-dione |
| SMILES | Cn1c(=O)c(C(=O)C2C(=O)CCCC2=O)cc2ccc(Br)cc21 |
| InChI | InChI=1S/C17H14BrNO4/c1-19-12-8-10(18)6-5-9(12)7-11(17(19)23)16(22)15-13(20)3-2-4-14(15)21/h5-8,15H,2-4H2,1H3 |
| InChIKey | JOKKMBYKEHYERX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|