C15H7ClN2O — CID 135034380
3-(3-chlorobenzoyl)benzene-1,2-dicarbonitrile (PubChem CID 135034380) has the molecular formula C15H7ClN2O and a molecular weight of 266.69 g/mol. Its IUPAC name is 3-(3-chlorobenzoyl)benzene-1,2-dicarbonitrile.
| Compound Name | 3-(3-chlorobenzoyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 135034380 |
| Molecular Formula | C15H7ClN2O |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 3-(3-chlorobenzoyl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(C(=O)c2cccc(Cl)c2)c1C#N |
| InChI | InChI=1S/C15H7ClN2O/c16-12-5-1-3-10(7-12)15(19)13-6-2-4-11(8-17)14(13)9-18/h1-7H |
| InChIKey | NSXBDQZUORMVDD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |