C25H26N4O5 — CID 135034575
methyl (6R,7S)-5-butyl-2-(4-methylphenyl)-6-(4-nitrophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-7-carboxylate (PubChem CID 135034575) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is methyl (6R,7S)-5-butyl-2-(4-methylphenyl)-6-(4-nitrophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-7-carboxylate.
| Compound Name | methyl (6R,7S)-5-butyl-2-(4-methylphenyl)-6-(4-nitrophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 135034575 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | methyl (6R,7S)-5-butyl-2-(4-methylphenyl)-6-(4-nitrophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazine-7-carboxylate |
| SMILES | CCCCN1C(=O)c2cc(-c3ccc(C)cc3)nn2[C@H](C(=O)OC)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H26N4O5/c1-4-5-14-27-22(18-10-12-19(13-11-18)29(32)33)23(25(31)34-3)28-21(24(27)30)15-20(26-28)17-8-6-16(2)7-9-17/h6-13,15,22-23H,4-5,14H2,1-3H3/t22-,23+/m1/s1 |
| InChIKey | XQMBFCIUOOZWKQ-PKTZIBPZSA-N |
| XLogP | 4.48 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|