C25H31FN2O5 — CID 135034691
diethyl (7S)-3-fluoro-3'-oxo-2-piperidin-1-ylspiro[8H-quinoline-7,4'-cyclohexane]-1',1'-dicarboxylate (PubChem CID 135034691) has the molecular formula C25H31FN2O5 and a molecular weight of 458.53 g/mol. Its IUPAC name is diethyl (7S)-3-fluoro-3'-oxo-2-piperidin-1-ylspiro[8H-quinoline-7,4'-cyclohexane]-1',1'-dicarboxylate.
| Compound Name | diethyl (7S)-3-fluoro-3'-oxo-2-piperidin-1-ylspiro[8H-quinoline-7,4'-cyclohexane]-1',1'-dicarboxylate |
|---|---|
| PubChem CID | 135034691 |
| Molecular Formula | C25H31FN2O5 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | diethyl (7S)-3-fluoro-3'-oxo-2-piperidin-1-ylspiro[8H-quinoline-7,4'-cyclohexane]-1',1'-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC[C@]2(C=Cc3cc(F)c(N4CCCCC4)nc3C2)C(=O)C1 |
| InChI | InChI=1S/C25H31FN2O5/c1-3-32-22(30)25(23(31)33-4-2)11-10-24(20(29)16-25)9-8-17-14-18(26)21(27-19(17)15-24)28-12-6-5-7-13-28/h8-9,14H,3-7,10-13,15-16H2,1-2H3/t24-/m0/s1 |
| InChIKey | ORBZVADRVXJEMK-DEOSSOPVSA-N |
| XLogP | 3.63 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|