About CID 135034827
CID 135034827 (PubChem CID 135034827) has the molecular formula C12H13N2OS
and a molecular weight of 233.32 g/mol.
Molecular Properties
| Compound Name | CID 135034827 |
| PubChem CID | 135034827 |
| Molecular Formula | C12H13N2OS |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | — |
| SMILES | C[C](CSC#N)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C12H13N2OS/c1-10(8-16-9-13)12(15)14(2)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3 |
| InChIKey | GUZJWCXMSFJXAT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze CID 135034827 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135034827?
The IUPAC name of CID 135034827 (CID 135034827) is not available.
What is the SMILES notation for CID 135034827?
The canonical SMILES for CID 135034827 is C[C](CSC#N)C(=O)N(C)c1ccccc1.
What is the InChIKey of CID 135034827?
The InChIKey is GUZJWCXMSFJXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N2OS/c1-10(8-16-9-13)12(15)14(2)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3.
What are the key properties of CID 135034827?
CID 135034827 has a molecular weight of 233.32 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135034827 is sourced from PubChem (CID 135034827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).