C9H9N3O2 — CID 135034992
4-methyl-2,4,6-triazatricyclo[5.2.2.02,6]undeca-8,10-diene-3,5-dione (PubChem CID 135034992) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-methyl-2,4,6-triazatricyclo[5.2.2.02,6]undeca-8,10-diene-3,5-dione.
| Compound Name | 4-methyl-2,4,6-triazatricyclo[5.2.2.02,6]undeca-8,10-diene-3,5-dione |
|---|---|
| PubChem CID | 135034992 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 4-methyl-2,4,6-triazatricyclo[5.2.2.02,6]undeca-8,10-diene-3,5-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C1C=CC2C=C1 |
| InChI | InChI=1S/C9H9N3O2/c1-10-8(13)11-6-2-3-7(5-4-6)12(11)9(10)14/h2-7H,1H3 |
| InChIKey | YPEKNXKNSKMLGY-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|