C23H40O5Si — CID 135035102
ethyl (3aS,5aS,8S,9aR,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][2]benzofuran-9a-carboxylate (PubChem CID 135035102) has the molecular formula C23H40O5Si and a molecular weight of 424.65 g/mol. Its IUPAC name is ethyl (3aS,5aS,8S,9aR,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][2]benzofuran-9a-carboxylate.
| Compound Name | ethyl (3aS,5aS,8S,9aR,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][2]benzofuran-9a-carboxylate |
|---|---|
| PubChem CID | 135035102 |
| Molecular Formula | C23H40O5Si |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | ethyl (3aS,5aS,8S,9aR,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][2]benzofuran-9a-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)[C@@H]1CC[C@@H]1C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C23H40O5Si/c1-9-26-20(25)23-13-15(28-29(7,8)21(2,3)4)12-22(5,6)18(23)11-10-16-17(23)14-27-19(16)24/h15-18H,9-14H2,1-8H3/t15-,16-,17-,18-,23-/m0/s1 |
| InChIKey | QHSJLAMBVJYUBV-IUUWJXCHSA-N |
| XLogP | 4.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|