C17H26O4 — CID 135035103
ethyl (3aS,5aS,9aR,9bS)-6,6-dimethyl-3-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][2]benzofuran-9a-carboxylate (PubChem CID 135035103) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is ethyl (3aS,5aS,9aR,9bS)-6,6-dimethyl-3-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][2]benzofuran-9a-carboxylate.
| Compound Name | ethyl (3aS,5aS,9aR,9bS)-6,6-dimethyl-3-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][2]benzofuran-9a-carboxylate |
|---|---|
| PubChem CID | 135035103 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | ethyl (3aS,5aS,9aR,9bS)-6,6-dimethyl-3-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][2]benzofuran-9a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCC(C)(C)[C@@H]1CC[C@@H]1C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C17H26O4/c1-4-20-15(19)17-9-5-8-16(2,3)13(17)7-6-11-12(17)10-21-14(11)18/h11-13H,4-10H2,1-3H3/t11-,12-,13-,17-/m0/s1 |
| InChIKey | OOCKAAKGCMQWDQ-MRHIQRDNSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |