C15H10BrN3O3 — CID 135035158
(3aS,8bS)-5-bromo-3-ethenyl-3a-nitro-3,8b-dihydro-2H-cyclopenta[b][1]benzofuran-1,1-dicarbonitrile (PubChem CID 135035158) has the molecular formula C15H10BrN3O3 and a molecular weight of 360.17 g/mol. Its IUPAC name is (3aS,8bS)-5-bromo-3-ethenyl-3a-nitro-3,8b-dihydro-2H-cyclopenta[b][1]benzofuran-1,1-dicarbonitrile.
| Compound Name | (3aS,8bS)-5-bromo-3-ethenyl-3a-nitro-3,8b-dihydro-2H-cyclopenta[b][1]benzofuran-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 135035158 |
| Molecular Formula | C15H10BrN3O3 |
| Molecular Weight | 360.17 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | (3aS,8bS)-5-bromo-3-ethenyl-3a-nitro-3,8b-dihydro-2H-cyclopenta[b][1]benzofuran-1,1-dicarbonitrile |
| SMILES | C=CC1CC(C#N)(C#N)[C@H]2c3cccc(Br)c3O[C@@]12[N+](=O)[O-] |
| InChI | InChI=1S/C15H10BrN3O3/c1-2-9-6-14(7-17,8-18)13-10-4-3-5-11(16)12(10)22-15(9,13)19(20)21/h2-5,9,13H,1,6H2/t9?,13-,15+/m1/s1 |
| InChIKey | IDLVNHAWDCTHOA-RJGUCTMASA-N |
| XLogP | 3.14 |
| TPSA | 99.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.17 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|