C19H28O5 — CID 135035191
(1-methoxy-1-oxopropan-2-yl) 3-[(1R,2R,4aS,8aR)-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-oxopropanoate (PubChem CID 135035191) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (1-methoxy-1-oxopropan-2-yl) 3-[(1R,2R,4aS,8aR)-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-oxopropanoate.
| Compound Name | (1-methoxy-1-oxopropan-2-yl) 3-[(1R,2R,4aS,8aR)-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 135035191 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (1-methoxy-1-oxopropan-2-yl) 3-[(1R,2R,4aS,8aR)-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-oxopropanoate |
| SMILES | COC(=O)C(C)OC(=O)CC(=O)[C@]1(C)[C@H](C)C=C[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C19H28O5/c1-12-9-10-14-7-5-6-8-15(14)19(12,3)16(20)11-17(21)24-13(2)18(22)23-4/h9-10,12-15H,5-8,11H2,1-4H3/t12-,13?,14+,15-,19-/m1/s1 |
| InChIKey | AVVLCUNMBAYTAS-NBLWIYHLSA-N |
| XLogP | 3.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|