C34H35NO8 — CID 135035497
5-O-ethyl 7-O,8-O-dimethyl (3aS,4R,9aS,9bR)-9-methyl-1,3-dioxo-2-phenyl-4-(2-phenylethyl)-3a,4,6,9,9a,9b-hexahydrobenzo[e]isoindole-5,7,8-tricarboxylate (PubChem CID 135035497) has the molecular formula C34H35NO8 and a molecular weight of 585.65 g/mol. Its IUPAC name is 5-O-ethyl 7-O,8-O-dimethyl (3aS,4R,9aS,9bR)-9-methyl-1,3-dioxo-2-phenyl-4-(2-phenylethyl)-3a,4,6,9,9a,9b-hexahydrobenzo[e]isoindole-5,7,8-tricarboxylate.
| Compound Name | 5-O-ethyl 7-O,8-O-dimethyl (3aS,4R,9aS,9bR)-9-methyl-1,3-dioxo-2-phenyl-4-(2-phenylethyl)-3a,4,6,9,9a,9b-hexahydrobenzo[e]isoindole-5,7,8-tricarboxylate |
|---|---|
| PubChem CID | 135035497 |
| Molecular Formula | C34H35NO8 |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | 5-O-ethyl 7-O,8-O-dimethyl (3aS,4R,9aS,9bR)-9-methyl-1,3-dioxo-2-phenyl-4-(2-phenylethyl)-3a,4,6,9,9a,9b-hexahydrobenzo[e]isoindole-5,7,8-tricarboxylate |
| SMILES | CCOC(=O)C1=C2CC(C(=O)OC)=C(C(=O)OC)C(C)[C@H]2[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C34H35NO8/c1-5-43-34(40)27-22(17-16-20-12-8-6-9-13-20)28-29(31(37)35(30(28)36)21-14-10-7-11-15-21)25-19(2)26(33(39)42-4)24(18-23(25)27)32(38)41-3/h6-15,19,22,25,28-29H,5,16-18H2,1-4H3/t19?,22-,25+,28-,29+/m0/s1 |
| InChIKey | HMRRMFIIXXZCAC-CGUQMEIKSA-N |
| XLogP | 4.21 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|