C7H10O3 — CID 135035537
2-hydroxy-4,6-dimethyl-2H-pyran-5-one (PubChem CID 135035537) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is 2-hydroxy-4,6-dimethyl-2H-pyran-5-one.
| Compound Name | 2-hydroxy-4,6-dimethyl-2H-pyran-5-one |
|---|---|
| PubChem CID | 135035537 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 2-hydroxy-4,6-dimethyl-2H-pyran-5-one |
| SMILES | CC1=CC(O)OC(C)C1=O |
| InChI | InChI=1S/C7H10O3/c1-4-3-6(8)10-5(2)7(4)9/h3,5-6,8H,1-2H3 |
| InChIKey | OSAJKURSCCPJHU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |