About 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran
2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran (PubChem CID 135035619) has the molecular formula C15H13ClOS
and a molecular weight of 276.79 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran |
| PubChem CID | 135035619 |
| Molecular Formula | C15H13ClOS |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran |
| SMILES | Clc1ccc(SCC2Cc3ccccc3O2)cc1 |
| InChI | InChI=1S/C15H13ClOS/c16-12-5-7-14(8-6-12)18-10-13-9-11-3-1-2-4-15(11)17-13/h1-8,13H,9-10H2 |
| InChIKey | ZRZHSTIDGVTJNH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran?
The IUPAC name of 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran (CID 135035619) is 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran?
The canonical SMILES for 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran is Clc1ccc(SCC2Cc3ccccc3O2)cc1.
What is the InChIKey of 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran?
The InChIKey is ZRZHSTIDGVTJNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClOS/c16-12-5-7-14(8-6-12)18-10-13-9-11-3-1-2-4-15(11)17-13/h1-8,13H,9-10H2.
What are the key properties of 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran?
2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran has a molecular weight of 276.79 g/mol, XLogP of 4.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)sulfanylmethyl]-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 135035619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).