C46H54O11 — CID 135035666
(6R,9S)-4,4,11,11-tetramethyl-8-[[(2S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 135035666) has the molecular formula C46H54O11 and a molecular weight of 782.93 g/mol. Its IUPAC name is (6R,9S)-4,4,11,11-tetramethyl-8-[[(2S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (6R,9S)-4,4,11,11-tetramethyl-8-[[(2S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 135035666 |
| Molecular Formula | C46H54O11 |
| Molecular Weight | 782.93 g/mol |
| Exact Mass | 782.37 |
| IUPAC Name | (6R,9S)-4,4,11,11-tetramethyl-8-[[(2S,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)OC2C3OC(C)(C)O[C@H]3C(CO[C@H]3OC(COCc4ccccc4)[C@H](OCc4ccccc4)C(OCc4ccccc4)C3OCc3ccccc3)O[C@@H]2O1 |
| InChI | InChI=1S/C46H54O11/c1-45(2)54-38-36(53-44-42(40(38)55-45)56-46(3,4)57-44)30-51-43-41(50-28-34-23-15-8-16-24-34)39(49-27-33-21-13-7-14-22-33)37(48-26-32-19-11-6-12-20-32)35(52-43)29-47-25-31-17-9-5-10-18-31/h5-24,35-44H,25-30H2,1-4H3/t35?,36?,37-,38-,39?,40?,41?,42?,43-,44+/m0/s1 |
| InChIKey | XIBZGKIHGHEEHR-WGGGVWDASA-N |
| XLogP | 7.10 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.93 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |