About methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate
methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate (PubChem CID 135035689) has the molecular formula C17H34O3Si
and a molecular weight of 314.54 g/mol. Its IUPAC name is methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate.
Molecular Properties
| Compound Name | methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate |
| PubChem CID | 135035689 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate |
| SMILES | COC(=O)/C(C)=C\CC[C@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O3Si/c1-14(10-9-11-15(2)16(18)19-6)12-13-20-21(7,8)17(3,4)5/h11,14H,9-10,12-13H2,1-8H3/b15-11-/t14-/m0/s1 |
| InChIKey | UCVOLBHOUGJGLO-XFNCEPBJSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate?
The IUPAC name of methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate (CID 135035689) is methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate.
What is the SMILES notation for methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate?
The canonical SMILES for methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate is COC(=O)/C(C)=C\CC[C@H](C)CCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate?
The InChIKey is UCVOLBHOUGJGLO-XFNCEPBJSA-N. The full InChI is InChI=1S/C17H34O3Si/c1-14(10-9-11-15(2)16(18)19-6)12-13-20-21(7,8)17(3,4)5/h11,14H,9-10,12-13H2,1-8H3/b15-11-/t14-/m0/s1.
What are the key properties of methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate?
methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate has a molecular weight of 314.54 g/mol, XLogP of 4.93, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z,6S)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-2-enoate is sourced from PubChem (CID 135035689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).