About 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene
2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene (PubChem CID 135035881) has the molecular formula C44H54S2
and a molecular weight of 647.05 g/mol. Its IUPAC name is 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene.
Molecular Properties
| Compound Name | 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene |
| PubChem CID | 135035881 |
| Molecular Formula | C44H54S2 |
| Molecular Weight | 647.05 g/mol |
| Exact Mass | 646.37 |
| IUPAC Name | 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene |
| SMILES | CCCCCCc1ccc(-c2cc3cc(C(C)(C)C)cc4cc(-c5ccc(CCCCCC)s5)c5cc(C(C)(C)C)cc2c5c34)s1 |
| InChI | InChI=1S/C44H54S2/c1-9-11-13-15-17-33-19-21-39(45-33)35-25-29-23-31(43(3,4)5)24-30-26-36(40-22-20-34(46-40)18-16-14-12-10-2)38-28-32(44(6,7)8)27-37(35)42(38)41(29)30/h19-28H,9-18H2,1-8H3 |
| InChIKey | DOWLGPYAXFDDMR-UHFFFAOYSA-N |
| XLogP | 14.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 647.05 |
| LogP ≤ 5 | 14.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene?
The IUPAC name of 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene (CID 135035881) is 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene.
What is the SMILES notation for 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene?
The canonical SMILES for 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene is CCCCCCc1ccc(-c2cc3cc(C(C)(C)C)cc4cc(-c5ccc(CCCCCC)s5)c5cc(C(C)(C)C)cc2c5c34)s1.
What is the InChIKey of 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene?
The InChIKey is DOWLGPYAXFDDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H54S2/c1-9-11-13-15-17-33-19-21-39(45-33)35-25-29-23-31(43(3,4)5)24-30-26-36(40-22-20-34(46-40)18-16-14-12-10-2)38-28-32(44(6,7)8)27-37(35)42(38)41(29)30/h19-28H,9-18H2,1-8H3.
What are the key properties of 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene?
2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene has a molecular weight of 647.05 g/mol, XLogP of 14.88, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,7-ditert-butyl-10-(5-hexylthiophen-2-yl)pyren-4-yl]-5-hexylthiophene is sourced from PubChem (CID 135035881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).