C38H76O3Si2Sn — CID 135035937
(1E,3S,4S,6E,8E,10S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethyl-1-tributylstannylundeca-1,6,8-trien-5-one (PubChem CID 135035937) has the molecular formula C38H76O3Si2Sn and a molecular weight of 755.91 g/mol. Its IUPAC name is (1E,3S,4S,6E,8E,10S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethyl-1-tributylstannylundeca-1,6,8-trien-5-one.
| Compound Name | (1E,3S,4S,6E,8E,10S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethyl-1-tributylstannylundeca-1,6,8-trien-5-one |
|---|---|
| PubChem CID | 135035937 |
| Molecular Formula | C38H76O3Si2Sn |
| Molecular Weight | 755.91 g/mol |
| Exact Mass | 756.44 |
| IUPAC Name | (1E,3S,4S,6E,8E,10S)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6,10-trimethyl-1-tributylstannylundeca-1,6,8-trien-5-one |
| SMILES | CCCC[Sn](/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)/C(C)=C/C=C/[C@H](C)CO[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C26H49O3Si2.3C4H9.Sn/c1-15-23(29-31(13,14)26(8,9)10)22(4)24(27)21(3)18-16-17-20(2)19-28-30(11,12)25(5,6)7;3*1-3-4-2;/h1,15-18,20,22-23H,19H2,2-14H3;3*1,3-4H2,2H3;/b15-1?,17-16+,21-18+;;;;/t20-,22-,23+;;;;/m0..../s1 |
| InChIKey | USDRAHVTSANODB-WGILMBODSA-N |
| XLogP | 12.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.91 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|