C21H14N4 — CID 135036038
1-methyl-4-phenyl-1,4-dihydronaphthalene-2,2,3,3-tetracarbonitrile (PubChem CID 135036038) has the molecular formula C21H14N4 and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-methyl-4-phenyl-1,4-dihydronaphthalene-2,2,3,3-tetracarbonitrile.
| Compound Name | 1-methyl-4-phenyl-1,4-dihydronaphthalene-2,2,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 135036038 |
| Molecular Formula | C21H14N4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-methyl-4-phenyl-1,4-dihydronaphthalene-2,2,3,3-tetracarbonitrile |
| SMILES | CC1c2ccccc2C(c2ccccc2)C(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C21H14N4/c1-15-17-9-5-6-10-18(17)19(16-7-3-2-4-8-16)21(13-24,14-25)20(15,11-22)12-23/h2-10,15,19H,1H3 |
| InChIKey | VJRJYJUDMJWCNK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|