C23H35NS — CID 135036063
(4R)-4-[(1Z,5E,7E,11R)-8,11-dimethyltetradeca-1,5,7,13-tetraenyl]-2-[(1R,2S)-2-methylcyclopropyl]-4,5-dihydro-1,3-thiazole (PubChem CID 135036063) has the molecular formula C23H35NS and a molecular weight of 357.61 g/mol. Its IUPAC name is (4R)-4-[(1Z,5E,7E,11R)-8,11-dimethyltetradeca-1,5,7,13-tetraenyl]-2-[(1R,2S)-2-methylcyclopropyl]-4,5-dihydro-1,3-thiazole.
| Compound Name | (4R)-4-[(1Z,5E,7E,11R)-8,11-dimethyltetradeca-1,5,7,13-tetraenyl]-2-[(1R,2S)-2-methylcyclopropyl]-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 135036063 |
| Molecular Formula | C23H35NS |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | (4R)-4-[(1Z,5E,7E,11R)-8,11-dimethyltetradeca-1,5,7,13-tetraenyl]-2-[(1R,2S)-2-methylcyclopropyl]-4,5-dihydro-1,3-thiazole |
| SMILES | C=CC[C@H](C)CC/C(C)=C/C=C/CC/C=C\[C@@H]1CSC([C@@H]2C[C@@H]2C)=N1 |
| InChI | InChI=1S/C23H35NS/c1-5-11-18(2)14-15-19(3)12-9-7-6-8-10-13-21-17-25-23(24-21)22-16-20(22)4/h5,7,9-10,12-13,18,20-22H,1,6,8,11,14-17H2,2-4H3/b9-7+,13-10-,19-12+/t18-,20-,21+,22+/m0/s1 |
| InChIKey | NSNYWKGSGACJSW-AJAZDLIQSA-N |
| XLogP | 6.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|