C21H32O3 — CID 135036446
(3aS,5aR,8aR,8bR)-3a,5a-dimethyl-6-[(2R)-6-methylhept-5-en-2-yl]-4,5,6,7,8a,8b-hexahydro-1H-cyclopenta[e][1]benzofuran-2,8-dione (PubChem CID 135036446) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (3aS,5aR,8aR,8bR)-3a,5a-dimethyl-6-[(2R)-6-methylhept-5-en-2-yl]-4,5,6,7,8a,8b-hexahydro-1H-cyclopenta[e][1]benzofuran-2,8-dione.
| Compound Name | (3aS,5aR,8aR,8bR)-3a,5a-dimethyl-6-[(2R)-6-methylhept-5-en-2-yl]-4,5,6,7,8a,8b-hexahydro-1H-cyclopenta[e][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 135036446 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (3aS,5aR,8aR,8bR)-3a,5a-dimethyl-6-[(2R)-6-methylhept-5-en-2-yl]-4,5,6,7,8a,8b-hexahydro-1H-cyclopenta[e][1]benzofuran-2,8-dione |
| SMILES | CC(C)=CCC[C@@H](C)C1CC(=O)[C@@H]2[C@H]3CC(=O)O[C@@]3(C)CC[C@]12C |
| InChI | InChI=1S/C21H32O3/c1-13(2)7-6-8-14(3)15-11-17(22)19-16-12-18(23)24-21(16,5)10-9-20(15,19)4/h7,14-16,19H,6,8-12H2,1-5H3/t14-,15?,16-,19+,20-,21+/m1/s1 |
| InChIKey | FRMFIMICAKMOEO-MRBFGBLDSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|