C23H23NO3 — CID 135036566
2-[(Z)-2-phenoxy-3-phenylprop-2-enyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 135036566) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[(Z)-2-phenoxy-3-phenylprop-2-enyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[(Z)-2-phenoxy-3-phenylprop-2-enyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 135036566 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-[(Z)-2-phenoxy-3-phenylprop-2-enyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1C2CCCCC2C(=O)N1C/C(=C/c1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C23H23NO3/c25-22-20-13-7-8-14-21(20)23(26)24(22)16-19(15-17-9-3-1-4-10-17)27-18-11-5-2-6-12-18/h1-6,9-12,15,20-21H,7-8,13-14,16H2/b19-15- |
| InChIKey | KBRYMEQEYZQPBP-CYVLTUHYSA-N |
| XLogP | 4.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|