About CID 135036588
CID 135036588 (PubChem CID 135036588) has the molecular formula C5H10NO
and a molecular weight of 100.14 g/mol.
Molecular Properties
| Compound Name | CID 135036588 |
| PubChem CID | 135036588 |
| Molecular Formula | C5H10NO |
| Molecular Weight | 100.14 g/mol |
| Exact Mass | 100.08 |
| IUPAC Name | — |
| SMILES | [CH2][C@H](NC)C(C)=O |
| InChI | InChI=1S/C5H10NO/c1-4(6-3)5(2)7/h4,6H,1H2,2-3H3/t4-/m0/s1 |
| InChIKey | ZLZSSPHADUPCGP-BYPYZUCNSA-N |
| XLogP | -0.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.14 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 135036588 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135036588?
The IUPAC name of CID 135036588 (CID 135036588) is not available.
What is the SMILES notation for CID 135036588?
The canonical SMILES for CID 135036588 is [CH2][C@H](NC)C(C)=O.
What is the InChIKey of CID 135036588?
The InChIKey is ZLZSSPHADUPCGP-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H10NO/c1-4(6-3)5(2)7/h4,6H,1H2,2-3H3/t4-/m0/s1.
What are the key properties of CID 135036588?
CID 135036588 has a molecular weight of 100.14 g/mol, XLogP of -0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135036588 is sourced from PubChem (CID 135036588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).