C14H22O — CID 135036678
(2R,3R)-2-butyl-3-[(2Z)-penta-2,4-dienyl]-3,6-dihydro-2H-pyran (PubChem CID 135036678) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (2R,3R)-2-butyl-3-[(2Z)-penta-2,4-dienyl]-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3R)-2-butyl-3-[(2Z)-penta-2,4-dienyl]-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 135036678 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (2R,3R)-2-butyl-3-[(2Z)-penta-2,4-dienyl]-3,6-dihydro-2H-pyran |
| SMILES | C=C/C=C\C[C@@H]1C=CCO[C@@H]1CCCC |
| InChI | InChI=1S/C14H22O/c1-3-5-7-9-13-10-8-12-15-14(13)11-6-4-2/h3,5,7-8,10,13-14H,1,4,6,9,11-12H2,2H3/b7-5-/t13-,14-/m1/s1 |
| InChIKey | ILMJGNTZTQUBAX-KMVAXQJASA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|