About (6E)-6-(methoxymethylidene)-3,4-dimethylundecane
(6E)-6-(methoxymethylidene)-3,4-dimethylundecane (PubChem CID 135036682) has the molecular formula C15H30O
and a molecular weight of 226.40 g/mol. Its IUPAC name is (6E)-6-(methoxymethylidene)-3,4-dimethylundecane.
Molecular Properties
| Compound Name | (6E)-6-(methoxymethylidene)-3,4-dimethylundecane |
| PubChem CID | 135036682 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | (6E)-6-(methoxymethylidene)-3,4-dimethylundecane |
| SMILES | CCCCC/C(=C\OC)CC(C)C(C)CC |
| InChI | InChI=1S/C15H30O/c1-6-8-9-10-15(12-16-5)11-14(4)13(3)7-2/h12-14H,6-11H2,1-5H3/b15-12+ |
| InChIKey | DNOKPPDOLGECOK-NTCAYCPXSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-(methoxymethylidene)-3,4-dimethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-(methoxymethylidene)-3,4-dimethylundecane?
The IUPAC name of (6E)-6-(methoxymethylidene)-3,4-dimethylundecane (CID 135036682) is (6E)-6-(methoxymethylidene)-3,4-dimethylundecane.
What is the SMILES notation for (6E)-6-(methoxymethylidene)-3,4-dimethylundecane?
The canonical SMILES for (6E)-6-(methoxymethylidene)-3,4-dimethylundecane is CCCCC/C(=C\OC)CC(C)C(C)CC.
What is the InChIKey of (6E)-6-(methoxymethylidene)-3,4-dimethylundecane?
The InChIKey is DNOKPPDOLGECOK-NTCAYCPXSA-N. The full InChI is InChI=1S/C15H30O/c1-6-8-9-10-15(12-16-5)11-14(4)13(3)7-2/h12-14H,6-11H2,1-5H3/b15-12+.
What are the key properties of (6E)-6-(methoxymethylidene)-3,4-dimethylundecane?
(6E)-6-(methoxymethylidene)-3,4-dimethylundecane has a molecular weight of 226.40 g/mol, XLogP of 5.17, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-(methoxymethylidene)-3,4-dimethylundecane is sourced from PubChem (CID 135036682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).