C20H34O2Si — CID 135036800
(1S,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-5,5,7a-trimethyl-1,2,3,6,6a,7-hexahydrocyclopenta[a]pentalen-4-one (PubChem CID 135036800) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is (1S,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-5,5,7a-trimethyl-1,2,3,6,6a,7-hexahydrocyclopenta[a]pentalen-4-one.
| Compound Name | (1S,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-5,5,7a-trimethyl-1,2,3,6,6a,7-hexahydrocyclopenta[a]pentalen-4-one |
|---|---|
| PubChem CID | 135036800 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (1S,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-5,5,7a-trimethyl-1,2,3,6,6a,7-hexahydrocyclopenta[a]pentalen-4-one |
| SMILES | CC1(C)CC2C[C@]3(C)C(=C2C1=O)CC[C@@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O2Si/c1-18(2,3)23(7,8)22-15-10-9-14-16-13(12-20(14,15)6)11-19(4,5)17(16)21/h13,15H,9-12H2,1-8H3/t13?,15-,20+/m0/s1 |
| InChIKey | BPLXKRNCQOHCGZ-HNMQNFMNSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|