C11H20O2 — CID 135036823
3-[(1R,3R)-3-(methoxymethyl)-2,2-dimethylcyclopropyl]-2,2-dimethyloxirane (PubChem CID 135036823) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-[(1R,3R)-3-(methoxymethyl)-2,2-dimethylcyclopropyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(1R,3R)-3-(methoxymethyl)-2,2-dimethylcyclopropyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 135036823 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 3-[(1R,3R)-3-(methoxymethyl)-2,2-dimethylcyclopropyl]-2,2-dimethyloxirane |
| SMILES | COC[C@@H]1[C@@H](C2OC2(C)C)C1(C)C |
| InChI | InChI=1S/C11H20O2/c1-10(2)7(6-12-5)8(10)9-11(3,4)13-9/h7-9H,6H2,1-5H3/t7-,8+,9?/m1/s1 |
| InChIKey | CSQBTNXOUCPYIK-WGTSGOJVSA-N |
| XLogP | 2.08 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|