C12H20O3 — CID 135036853
cis-ethyl (1S,3R)-3-[(2R)-3,3-dimethyloxiran-2-yl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 135036853) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is cis-ethyl (1S,3R)-3-[(2R)-3,3-dimethyloxiran-2-yl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1S,3R)-3-[(2R)-3,3-dimethyloxiran-2-yl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 135036853 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | cis-ethyl (1S,3R)-3-[(2R)-3,3-dimethyloxiran-2-yl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]([C@H]2OC2(C)C)C1(C)C |
| InChI | InChI=1S/C12H20O3/c1-6-14-10(13)8-7(11(8,2)3)9-12(4,5)15-9/h7-9H,6H2,1-5H3/t7-,8+,9+/m0/s1 |
| InChIKey | OVNNFOXFDCYARR-DJLDLDEBSA-N |
| XLogP | 2.00 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|