C13H22O5 — CID 135036884
(3aR,5R,6aR)-5-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-6-methylidene-3a,6a-dihydrofuro[2,3-d][1,3]dioxole (PubChem CID 135036884) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (3aR,5R,6aR)-5-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-6-methylidene-3a,6a-dihydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6aR)-5-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-6-methylidene-3a,6a-dihydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 135036884 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (3aR,5R,6aR)-5-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-6-methylidene-3a,6a-dihydrofuro[2,3-d][1,3]dioxole |
| SMILES | C=C1[C@H](COC(C)(C)OC)O[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C13H22O5/c1-8-9(7-15-12(2,3)14-6)16-11-10(8)17-13(4,5)18-11/h9-11H,1,7H2,2-6H3/t9-,10+,11+/m0/s1 |
| InChIKey | OZWJESBABMPPSY-HBNTYKKESA-N |
| XLogP | 1.82 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|