C8H13O3U- — CID 135036985
(2R,3S,4S)-2-(hydroxymethyl)-4-prop-2-enyl-2,3,4,5-tetrahydrofuran-5-id-3-ol;uranium (PubChem CID 135036985) has the molecular formula C8H13O3U- and a molecular weight of 395.22 g/mol. Its IUPAC name is (2R,3S,4S)-2-(hydroxymethyl)-4-prop-2-enyl-2,3,4,5-tetrahydrofuran-5-id-3-ol;uranium.
| Compound Name | (2R,3S,4S)-2-(hydroxymethyl)-4-prop-2-enyl-2,3,4,5-tetrahydrofuran-5-id-3-ol;uranium |
|---|---|
| PubChem CID | 135036985 |
| Molecular Formula | C8H13O3U- |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (2R,3S,4S)-2-(hydroxymethyl)-4-prop-2-enyl-2,3,4,5-tetrahydrofuran-5-id-3-ol;uranium |
| SMILES | C=CC[C@H]1[CH-]O[C@H](CO)[C@H]1O.[U] |
| InChI | InChI=1S/C8H13O3.U/c1-2-3-6-5-11-7(4-9)8(6)10;/h2,5-10H,1,3-4H2;/q-1;/t6-,7+,8-;/m0./s1 |
| InChIKey | PYNWTZCAERVKKN-CZEXFEQNSA-N |
| XLogP | 0.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|