C12H19BrO4 — CID 135037015
2-[(1S,3R,4R,5R)-3-bromo-4,5-dihydroxy-4-methylcyclohexyl]prop-2-enyl acetate (PubChem CID 135037015) has the molecular formula C12H19BrO4 and a molecular weight of 307.18 g/mol. Its IUPAC name is 2-[(1S,3R,4R,5R)-3-bromo-4,5-dihydroxy-4-methylcyclohexyl]prop-2-enyl acetate.
| Compound Name | 2-[(1S,3R,4R,5R)-3-bromo-4,5-dihydroxy-4-methylcyclohexyl]prop-2-enyl acetate |
|---|---|
| PubChem CID | 135037015 |
| Molecular Formula | C12H19BrO4 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-[(1S,3R,4R,5R)-3-bromo-4,5-dihydroxy-4-methylcyclohexyl]prop-2-enyl acetate |
| SMILES | C=C(COC(C)=O)[C@H]1C[C@@H](O)[C@@](C)(O)[C@H](Br)C1 |
| InChI | InChI=1S/C12H19BrO4/c1-7(6-17-8(2)14)9-4-10(13)12(3,16)11(15)5-9/h9-11,15-16H,1,4-6H2,2-3H3/t9-,10-,11-,12+/m1/s1 |
| InChIKey | XLICARJIYFFLDX-KKOKHZNYSA-N |
| XLogP | 1.39 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|