C14H18O4 — CID 135037058
ethyl (1R,5S,7R)-6-methylidene-8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate (PubChem CID 135037058) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is ethyl (1R,5S,7R)-6-methylidene-8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate.
| Compound Name | ethyl (1R,5S,7R)-6-methylidene-8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate |
|---|---|
| PubChem CID | 135037058 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl (1R,5S,7R)-6-methylidene-8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate |
| SMILES | C=C1[C@@H]2CCC[C@@]23CCC(=O)[C@]1(C(=O)OCC)O3 |
| InChI | InChI=1S/C14H18O4/c1-3-17-12(16)14-9(2)10-5-4-7-13(10,18-14)8-6-11(14)15/h10H,2-8H2,1H3/t10-,13+,14+/m0/s1 |
| InChIKey | OCEBGYFSMRBSHA-ZLKJLUDKSA-N |
| XLogP | 1.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|