C9H15NO3 — CID 135037160
(3aR,7aS)-3-nitro-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol (PubChem CID 135037160) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (3aR,7aS)-3-nitro-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol.
| Compound Name | (3aR,7aS)-3-nitro-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
|---|---|
| PubChem CID | 135037160 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (3aR,7aS)-3-nitro-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
| SMILES | O=[N+]([O-])C1CC[C@@H]2CCCC[C@]12O |
| InChI | InChI=1S/C9H15NO3/c11-9-6-2-1-3-7(9)4-5-8(9)10(12)13/h7-8,11H,1-6H2/t7-,8?,9+/m0/s1 |
| InChIKey | ANROZGTVLKPMLA-UBGVJBJISA-N |
| XLogP | 1.35 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|