C14H22O2 — CID 135037244
(3aS,6aR,10R,10aS)-5,5,10-trimethyl-2,3,3a,6a,7,10-hexahydro-1H-cyclopenta[d][1,3]benzodioxine (PubChem CID 135037244) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3aS,6aR,10R,10aS)-5,5,10-trimethyl-2,3,3a,6a,7,10-hexahydro-1H-cyclopenta[d][1,3]benzodioxine.
| Compound Name | (3aS,6aR,10R,10aS)-5,5,10-trimethyl-2,3,3a,6a,7,10-hexahydro-1H-cyclopenta[d][1,3]benzodioxine |
|---|---|
| PubChem CID | 135037244 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3aS,6aR,10R,10aS)-5,5,10-trimethyl-2,3,3a,6a,7,10-hexahydro-1H-cyclopenta[d][1,3]benzodioxine |
| SMILES | C[C@@H]1C=CC[C@H]2OC(C)(C)O[C@H]3CCC[C@]132 |
| InChI | InChI=1S/C14H22O2/c1-10-6-4-7-11-14(10)9-5-8-12(14)16-13(2,3)15-11/h4,6,10-12H,5,7-9H2,1-3H3/t10-,11-,12+,14-/m1/s1 |
| InChIKey | PDLXVTFSKFALPJ-NRWUCQMLSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|