About [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol
[(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol (PubChem CID 135037248) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol.
Molecular Properties
| Compound Name | [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol |
| PubChem CID | 135037248 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol |
| SMILES | CCN1C[C@H]2CCC[C@@](CO)(C1)C2OC |
| InChI | InChI=1S/C12H23NO2/c1-3-13-7-10-5-4-6-12(8-13,9-14)11(10)15-2/h10-11,14H,3-9H2,1-2H3/t10-,11?,12+/m1/s1 |
| InChIKey | KNGHULBPWYHXLW-LWALXPGCSA-N |
| XLogP | 1.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol?
The IUPAC name of [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol (CID 135037248) is [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol.
What is the SMILES notation for [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol?
The canonical SMILES for [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol is CCN1C[C@H]2CCC[C@@](CO)(C1)C2OC.
What is the InChIKey of [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol?
The InChIKey is KNGHULBPWYHXLW-LWALXPGCSA-N. The full InChI is InChI=1S/C12H23NO2/c1-3-13-7-10-5-4-6-12(8-13,9-14)11(10)15-2/h10-11,14H,3-9H2,1-2H3/t10-,11?,12+/m1/s1.
What are the key properties of [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol?
[(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol has a molecular weight of 213.32 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-3-ethyl-9-methoxy-3-azabicyclo[3.3.1]nonan-1-yl]methanol is sourced from PubChem (CID 135037248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).