About [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine
[4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine (PubChem CID 135037261) has the molecular formula C6H16N2
and a molecular weight of 122.24 g/mol. Its IUPAC name is [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine.
Molecular Properties
| Compound Name | [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine |
| PubChem CID | 135037261 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 122.24 g/mol |
| Exact Mass | 122.17 |
| IUPAC Name | [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])C(C)(C)NN |
| InChI | InChI=1S/C6H16N2/c1-5(2)6(3,4)8-7/h5,8H,7H2,1-4H3/i1D3,2D3 |
| InChIKey | INYVLUCMORBCAG-WFGJKAKNSA-N |
| XLogP | 0.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine?
The IUPAC name of [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine (CID 135037261) is [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine.
What is the SMILES notation for [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine?
The canonical SMILES for [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine is [2H]C([2H])([2H])C(C([2H])([2H])[2H])C(C)(C)NN.
What is the InChIKey of [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine?
The InChIKey is INYVLUCMORBCAG-WFGJKAKNSA-N. The full InChI is InChI=1S/C6H16N2/c1-5(2)6(3,4)8-7/h5,8H,7H2,1-4H3/i1D3,2D3.
What are the key properties of [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine?
[4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine has a molecular weight of 122.24 g/mol, XLogP of 0.88, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4,4-trideuterio-2-methyl-3-(trideuteriomethyl)butan-2-yl]hydrazine is sourced from PubChem (CID 135037261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).