About benzyl 4-oxoheptan-3-yl carbonate
benzyl 4-oxoheptan-3-yl carbonate (PubChem CID 135037273) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is benzyl 4-oxoheptan-3-yl carbonate.
Molecular Properties
| Compound Name | benzyl 4-oxoheptan-3-yl carbonate |
| PubChem CID | 135037273 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | benzyl 4-oxoheptan-3-yl carbonate |
| SMILES | CCCC(=O)C(CC)OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20O4/c1-3-8-13(16)14(4-2)19-15(17)18-11-12-9-6-5-7-10-12/h5-7,9-10,14H,3-4,8,11H2,1-2H3 |
| InChIKey | AWDCAAIJBCMBGN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 4-oxoheptan-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-oxoheptan-3-yl carbonate?
The IUPAC name of benzyl 4-oxoheptan-3-yl carbonate (CID 135037273) is benzyl 4-oxoheptan-3-yl carbonate.
What is the SMILES notation for benzyl 4-oxoheptan-3-yl carbonate?
The canonical SMILES for benzyl 4-oxoheptan-3-yl carbonate is CCCC(=O)C(CC)OC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 4-oxoheptan-3-yl carbonate?
The InChIKey is AWDCAAIJBCMBGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-3-8-13(16)14(4-2)19-15(17)18-11-12-9-6-5-7-10-12/h5-7,9-10,14H,3-4,8,11H2,1-2H3.
What are the key properties of benzyl 4-oxoheptan-3-yl carbonate?
benzyl 4-oxoheptan-3-yl carbonate has a molecular weight of 264.32 g/mol, XLogP of 3.49, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-oxoheptan-3-yl carbonate is sourced from PubChem (CID 135037273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).