About (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine
(3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine (PubChem CID 135037327) has the molecular formula C12H24FN
and a molecular weight of 201.33 g/mol. Its IUPAC name is (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine.
Molecular Properties
| Compound Name | (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine |
| PubChem CID | 135037327 |
| Molecular Formula | C12H24FN |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine |
| SMILES | CC[C@@]1(F)CCCN(CC(C)(C)C)C1 |
| InChI | InChI=1S/C12H24FN/c1-5-12(13)7-6-8-14(10-12)9-11(2,3)4/h5-10H2,1-4H3/t12-/m1/s1 |
| InChIKey | MUTYEVROWRYSHI-GFCCVEGCSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine?
The IUPAC name of (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine (CID 135037327) is (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine.
What is the SMILES notation for (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine?
The canonical SMILES for (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine is CC[C@@]1(F)CCCN(CC(C)(C)C)C1.
What is the InChIKey of (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine?
The InChIKey is MUTYEVROWRYSHI-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H24FN/c1-5-12(13)7-6-8-14(10-12)9-11(2,3)4/h5-10H2,1-4H3/t12-/m1/s1.
What are the key properties of (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine?
(3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine has a molecular weight of 201.33 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2,2-dimethylpropyl)-3-ethyl-3-fluoropiperidine is sourced from PubChem (CID 135037327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).