About [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol
[(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol (PubChem CID 135037345) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol |
| PubChem CID | 135037345 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol |
| SMILES | C=CC[C@@]1(CO)CCCN1CC(C)(C)C |
| InChI | InChI=1S/C13H25NO/c1-5-7-13(11-15)8-6-9-14(13)10-12(2,3)4/h5,15H,1,6-11H2,2-4H3/t13-/m0/s1 |
| InChIKey | MKPGORMNSVZZAW-ZDUSSCGKSA-N |
| XLogP | 2.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol?
The IUPAC name of [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol (CID 135037345) is [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol?
The canonical SMILES for [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol is C=CC[C@@]1(CO)CCCN1CC(C)(C)C.
What is the InChIKey of [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol?
The InChIKey is MKPGORMNSVZZAW-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H25NO/c1-5-7-13(11-15)8-6-9-14(13)10-12(2,3)4/h5,15H,1,6-11H2,2-4H3/t13-/m0/s1.
What are the key properties of [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol?
[(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol has a molecular weight of 211.35 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-(2,2-dimethylpropyl)-2-prop-2-enylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 135037345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).