About 2-benzyl-1H-pyrrolo[2,3-d]pyridazine
2-benzyl-1H-pyrrolo[2,3-d]pyridazine (PubChem CID 135037367) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-benzyl-1H-pyrrolo[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 2-benzyl-1H-pyrrolo[2,3-d]pyridazine |
| PubChem CID | 135037367 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-benzyl-1H-pyrrolo[2,3-d]pyridazine |
| SMILES | c1ccc(Cc2cc3cnncc3[nH]2)cc1 |
| InChI | InChI=1S/C13H11N3/c1-2-4-10(5-3-1)6-12-7-11-8-14-15-9-13(11)16-12/h1-5,7-9,16H,6H2 |
| InChIKey | LJQBKKUJTQQJJU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-1H-pyrrolo[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1H-pyrrolo[2,3-d]pyridazine?
The IUPAC name of 2-benzyl-1H-pyrrolo[2,3-d]pyridazine (CID 135037367) is 2-benzyl-1H-pyrrolo[2,3-d]pyridazine.
What is the SMILES notation for 2-benzyl-1H-pyrrolo[2,3-d]pyridazine?
The canonical SMILES for 2-benzyl-1H-pyrrolo[2,3-d]pyridazine is c1ccc(Cc2cc3cnncc3[nH]2)cc1.
What is the InChIKey of 2-benzyl-1H-pyrrolo[2,3-d]pyridazine?
The InChIKey is LJQBKKUJTQQJJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c1-2-4-10(5-3-1)6-12-7-11-8-14-15-9-13(11)16-12/h1-5,7-9,16H,6H2.
What are the key properties of 2-benzyl-1H-pyrrolo[2,3-d]pyridazine?
2-benzyl-1H-pyrrolo[2,3-d]pyridazine has a molecular weight of 209.25 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1H-pyrrolo[2,3-d]pyridazine is sourced from PubChem (CID 135037367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).