About [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane
[(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane (PubChem CID 135037502) has the molecular formula C14H24F2
and a molecular weight of 230.34 g/mol. Its IUPAC name is [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane.
Molecular Properties
| Compound Name | [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane |
| PubChem CID | 135037502 |
| Molecular Formula | C14H24F2 |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane |
| SMILES | F[C@@H](C1CCCCC1)[C@@H](F)C1CCCCC1 |
| InChI | InChI=1S/C14H24F2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h11-14H,1-10H2/t13-,14-/m0/s1 |
| InChIKey | NCHPKLMXLSNKIV-KBPBESRZSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane?
The IUPAC name of [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane (CID 135037502) is [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane.
What is the SMILES notation for [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane?
The canonical SMILES for [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane is F[C@@H](C1CCCCC1)[C@@H](F)C1CCCCC1.
What is the InChIKey of [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane?
The InChIKey is NCHPKLMXLSNKIV-KBPBESRZSA-N. The full InChI is InChI=1S/C14H24F2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h11-14H,1-10H2/t13-,14-/m0/s1.
What are the key properties of [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane?
[(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane has a molecular weight of 230.34 g/mol, XLogP of 4.82, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-cyclohexyl-1,2-difluoroethyl]cyclohexane is sourced from PubChem (CID 135037502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).