C11H18O — CID 135037566
(2R,3R,5R)-3-ethenyl-2,3-dimethyl-5-prop-2-enyloxolane (PubChem CID 135037566) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (2R,3R,5R)-3-ethenyl-2,3-dimethyl-5-prop-2-enyloxolane.
| Compound Name | (2R,3R,5R)-3-ethenyl-2,3-dimethyl-5-prop-2-enyloxolane |
|---|---|
| PubChem CID | 135037566 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (2R,3R,5R)-3-ethenyl-2,3-dimethyl-5-prop-2-enyloxolane |
| SMILES | C=CC[C@@H]1C[C@](C)(C=C)[C@@H](C)O1 |
| InChI | InChI=1S/C11H18O/c1-5-7-10-8-11(4,6-2)9(3)12-10/h5-6,9-10H,1-2,7-8H2,3-4H3/t9-,10-,11+/m1/s1 |
| InChIKey | LPFSNRHTBTUATM-MXWKQRLJSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|