C11H19LiO2 — CID 135037587
lithium (2S,3S,6R)-2-[(2S)-butan-2-yl]-6-methoxy-3-methyl-3,6-dihydro-2H-pyran (PubChem CID 135037587) has the molecular formula C11H19LiO2 and a molecular weight of 190.21 g/mol. Its IUPAC name is lithium (2S,3S,6R)-2-[(2S)-butan-2-yl]-6-methoxy-3-methyl-3,6-dihydro-2H-pyran.
| Compound Name | lithium (2S,3S,6R)-2-[(2S)-butan-2-yl]-6-methoxy-3-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 135037587 |
| Molecular Formula | C11H19LiO2 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | lithium (2S,3S,6R)-2-[(2S)-butan-2-yl]-6-methoxy-3-methyl-3,6-dihydro-2H-pyran |
| SMILES | [CH2-]C[C@H](C)[C@@H]1O[C@@H](OC)C=C[C@@H]1C.[Li+] |
| InChI | InChI=1S/C11H19O2.Li/c1-5-8(2)11-9(3)6-7-10(12-4)13-11;/h6-11H,1,5H2,2-4H3;/q-1;+1/t8-,9-,10+,11-;/m0./s1 |
| InChIKey | IKJCZRUAVWQVKL-CWXCEVAHSA-N |
| XLogP | -0.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|