About 3,5-diphenyl-1,2-oxazolidine
3,5-diphenyl-1,2-oxazolidine (PubChem CID 135037666) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is 3,5-diphenyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | 3,5-diphenyl-1,2-oxazolidine |
| PubChem CID | 135037666 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3,5-diphenyl-1,2-oxazolidine |
| SMILES | c1ccc(C2CC(c3ccccc3)ON2)cc1 |
| InChI | InChI=1S/C15H15NO/c1-3-7-12(8-4-1)14-11-15(17-16-14)13-9-5-2-6-10-13/h1-10,14-16H,11H2 |
| InChIKey | FCVIDHGKFVWYKF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-diphenyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diphenyl-1,2-oxazolidine?
The IUPAC name of 3,5-diphenyl-1,2-oxazolidine (CID 135037666) is 3,5-diphenyl-1,2-oxazolidine.
What is the SMILES notation for 3,5-diphenyl-1,2-oxazolidine?
The canonical SMILES for 3,5-diphenyl-1,2-oxazolidine is c1ccc(C2CC(c3ccccc3)ON2)cc1.
What is the InChIKey of 3,5-diphenyl-1,2-oxazolidine?
The InChIKey is FCVIDHGKFVWYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO/c1-3-7-12(8-4-1)14-11-15(17-16-14)13-9-5-2-6-10-13/h1-10,14-16H,11H2.
What are the key properties of 3,5-diphenyl-1,2-oxazolidine?
3,5-diphenyl-1,2-oxazolidine has a molecular weight of 225.29 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diphenyl-1,2-oxazolidine is sourced from PubChem (CID 135037666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).