About 2,4,5-trimethoxy-N,3-dimethylaniline
2,4,5-trimethoxy-N,3-dimethylaniline (PubChem CID 135037705) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N,3-dimethylaniline.
Molecular Properties
| Compound Name | 2,4,5-trimethoxy-N,3-dimethylaniline |
| PubChem CID | 135037705 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2,4,5-trimethoxy-N,3-dimethylaniline |
| SMILES | CNc1cc(OC)c(OC)c(C)c1OC |
| InChI | InChI=1S/C11H17NO3/c1-7-10(14-4)8(12-2)6-9(13-3)11(7)15-5/h6,12H,1-5H3 |
| InChIKey | IFKZXAIUQDAHEK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5-trimethoxy-N,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trimethoxy-N,3-dimethylaniline?
The IUPAC name of 2,4,5-trimethoxy-N,3-dimethylaniline (CID 135037705) is 2,4,5-trimethoxy-N,3-dimethylaniline.
What is the SMILES notation for 2,4,5-trimethoxy-N,3-dimethylaniline?
The canonical SMILES for 2,4,5-trimethoxy-N,3-dimethylaniline is CNc1cc(OC)c(OC)c(C)c1OC.
What is the InChIKey of 2,4,5-trimethoxy-N,3-dimethylaniline?
The InChIKey is IFKZXAIUQDAHEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-7-10(14-4)8(12-2)6-9(13-3)11(7)15-5/h6,12H,1-5H3.
What are the key properties of 2,4,5-trimethoxy-N,3-dimethylaniline?
2,4,5-trimethoxy-N,3-dimethylaniline has a molecular weight of 211.26 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trimethoxy-N,3-dimethylaniline is sourced from PubChem (CID 135037705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).