C14H18NO4+ — CID 135037769
[(2R,3R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-oxo-1-phenylazetidin-3-yl]oxidanium (PubChem CID 135037769) has the molecular formula C14H18NO4+ and a molecular weight of 264.30 g/mol. Its IUPAC name is [(2R,3R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-oxo-1-phenylazetidin-3-yl]oxidanium.
| Compound Name | [(2R,3R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-oxo-1-phenylazetidin-3-yl]oxidanium |
|---|---|
| PubChem CID | 135037769 |
| Molecular Formula | C14H18NO4+ |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [(2R,3R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-oxo-1-phenylazetidin-3-yl]oxidanium |
| SMILES | CC1(C)OCC([C@H]2[C@@H]([OH2+])C(=O)N2c2ccccc2)O1 |
| InChI | InChI=1S/C14H17NO4/c1-14(2)18-8-10(19-14)11-12(16)13(17)15(11)9-6-4-3-5-7-9/h3-7,10-12,16H,8H2,1-2H3/p+1/t10?,11-,12+/m0/s1 |
| InChIKey | CPLOUIFFWATGTM-GLXQMMQGSA-O |
| XLogP | 0.65 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|