C12H26O4Si — CID 135037883
(3R,6R,7R)-7-(hydroxymethyl)-2,2-dimethyl-6-trimethylsilyloxepane-3,6-diol (PubChem CID 135037883) has the molecular formula C12H26O4Si and a molecular weight of 262.42 g/mol. Its IUPAC name is (3R,6R,7R)-7-(hydroxymethyl)-2,2-dimethyl-6-trimethylsilyloxepane-3,6-diol.
| Compound Name | (3R,6R,7R)-7-(hydroxymethyl)-2,2-dimethyl-6-trimethylsilyloxepane-3,6-diol |
|---|---|
| PubChem CID | 135037883 |
| Molecular Formula | C12H26O4Si |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (3R,6R,7R)-7-(hydroxymethyl)-2,2-dimethyl-6-trimethylsilyloxepane-3,6-diol |
| SMILES | CC1(C)O[C@H](CO)[C@](O)([Si](C)(C)C)CC[C@H]1O |
| InChI | InChI=1S/C12H26O4Si/c1-11(2)9(14)6-7-12(15,17(3,4)5)10(8-13)16-11/h9-10,13-15H,6-8H2,1-5H3/t9-,10-,12-/m1/s1 |
| InChIKey | IMFCGYYMSQHPQM-CKYFFXLPSA-N |
| XLogP | 0.91 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|