C14H18NO4+ — CID 135038053
(Z)-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-benzylidene-hydroxyazanium (PubChem CID 135038053) has the molecular formula C14H18NO4+ and a molecular weight of 264.30 g/mol. Its IUPAC name is (Z)-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-benzylidene-hydroxyazanium.
| Compound Name | (Z)-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-benzylidene-hydroxyazanium |
|---|---|
| PubChem CID | 135038053 |
| Molecular Formula | C14H18NO4+ |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (Z)-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-benzylidene-hydroxyazanium |
| SMILES | CC1(C)O[C@H]2[C@H](/[N+](O)=C/c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C14H18NO4/c1-14(2)18-11-9-17-13(12(11)19-14)15(16)8-10-6-4-3-5-7-10/h3-8,11-13,16H,9H2,1-2H3/q+1/b15-8-/t11-,12-,13-/m1/s1 |
| InChIKey | YSPHNPSUWHJYRY-USGHFZIVSA-N |
| XLogP | 1.38 |
| TPSA | 50.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|