About (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one
(3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one (PubChem CID 135038101) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one.
Molecular Properties
| Compound Name | (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one |
| PubChem CID | 135038101 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one |
| SMILES | CC[C@H]1C(=O)N(C)[C@H]1C |
| InChI | InChI=1S/C7H13NO/c1-4-6-5(2)8(3)7(6)9/h5-6H,4H2,1-3H3/t5-,6+/m0/s1 |
| InChIKey | UYOXZRVHIMKCRM-NTSWFWBYSA-N |
| XLogP | 0.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one?
The IUPAC name of (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one (CID 135038101) is (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one.
What is the SMILES notation for (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one?
The canonical SMILES for (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one is CC[C@H]1C(=O)N(C)[C@H]1C.
What is the InChIKey of (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one?
The InChIKey is UYOXZRVHIMKCRM-NTSWFWBYSA-N. The full InChI is InChI=1S/C7H13NO/c1-4-6-5(2)8(3)7(6)9/h5-6H,4H2,1-3H3/t5-,6+/m0/s1.
What are the key properties of (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one?
(3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one has a molecular weight of 127.19 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3-ethyl-1,4-dimethylazetidin-2-one is sourced from PubChem (CID 135038101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).