C15H24O3 — CID 135038110
(3R)-3-[(1R)-1-prop-2-enoxybut-2-enyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 135038110) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3R)-3-[(1R)-1-prop-2-enoxybut-2-enyl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | (3R)-3-[(1R)-1-prop-2-enoxybut-2-enyl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 135038110 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3R)-3-[(1R)-1-prop-2-enoxybut-2-enyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | C=CCO[C@H](C=CC)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C15H24O3/c1-3-8-13(16-11-4-2)14-12-17-15(18-14)9-6-5-7-10-15/h3-4,8,13-14H,2,5-7,9-12H2,1H3/t13-,14-/m1/s1 |
| InChIKey | VZMLEJOZAAGTEV-ZIAGYGMSSA-N |
| XLogP | 3.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|